C18H13N5O5S2 — CID 58565762
N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzenesulfonamide (PubChem CID 58565762) has the molecular formula C18H13N5O5S2 and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 58565762 |
| Molecular Formula | C18H13N5O5S2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cc(Sc3ncn[nH]3)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C18H13N5O5S2/c24-17-14-4-2-1-3-13(14)15(9-16(17)29-18-19-10-20-21-18)22-30(27,28)12-7-5-11(6-8-12)23(25)26/h1-10,22,24H,(H,19,20,21) |
| InChIKey | FMIGSWSWNCFTQX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|