C22H19N5O3S2 — CID 89122569
2-amino-3-[(1Z)-buta-1,3-dienyl]-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]benzenesulfonamide (PubChem CID 89122569) has the molecular formula C22H19N5O3S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 2-amino-3-[(1Z)-buta-1,3-dienyl]-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]benzenesulfonamide.
| Compound Name | 2-amino-3-[(1Z)-buta-1,3-dienyl]-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 89122569 |
| Molecular Formula | C22H19N5O3S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-amino-3-[(1Z)-buta-1,3-dienyl]-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]benzenesulfonamide |
| SMILES | C=C/C=C\c1cccc(S(=O)(=O)Nc2cc(Sc3ncn[nH]3)c(O)c3ccccc23)c1N |
| InChI | InChI=1S/C22H19N5O3S2/c1-2-3-7-14-8-6-11-19(20(14)23)32(29,30)27-17-12-18(31-22-24-13-25-26-22)21(28)16-10-5-4-9-15(16)17/h2-13,27-28H,1,23H2,(H,24,25,26)/b7-3- |
| InChIKey | NFIUXPOMVWRHMD-CLTKARDFSA-N |
| XLogP | 4.40 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|