C19H16N5O5S2+ — CID 123955658
N-[4-hydroxy-3-[(4-methylidene-1,5-dihydro-1,2,4-triazol-4-ium-3-yl)sulfanyl]naphthalen-1-yl]-4-nitrobenzenesulfonamide (PubChem CID 123955658) has the molecular formula C19H16N5O5S2+ and a molecular weight of 458.50 g/mol. Its IUPAC name is N-[4-hydroxy-3-[(4-methylidene-1,5-dihydro-1,2,4-triazol-4-ium-3-yl)sulfanyl]naphthalen-1-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-hydroxy-3-[(4-methylidene-1,5-dihydro-1,2,4-triazol-4-ium-3-yl)sulfanyl]naphthalen-1-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 123955658 |
| Molecular Formula | C19H16N5O5S2+ |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-[4-hydroxy-3-[(4-methylidene-1,5-dihydro-1,2,4-triazol-4-ium-3-yl)sulfanyl]naphthalen-1-yl]-4-nitrobenzenesulfonamide |
| SMILES | C=[N+]1CNN=C1Sc1cc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc2c1O |
| InChI | InChI=1S/C19H15N5O5S2/c1-23-11-20-21-19(23)30-17-10-16(14-4-2-3-5-15(14)18(17)25)22-31(28,29)13-8-6-12(7-9-13)24(26)27/h2-10,20,22H,1,11H2/p+1 |
| InChIKey | LJHAEDMCLANFHK-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|