C32H24N4O3S2 — CID 2231022
N-[3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-4-hydroxynaphthalen-1-yl]-4-methylbenzenesulfonamide (PubChem CID 2231022) has the molecular formula C32H24N4O3S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is N-[3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-4-hydroxynaphthalen-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-4-hydroxynaphthalen-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2231022 |
| Molecular Formula | C32H24N4O3S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | N-[3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-4-hydroxynaphthalen-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(Sc3nnc(-c4ccccc4)c(-c4ccccc4)n3)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C32H24N4O3S2/c1-21-16-18-24(19-17-21)41(38,39)36-27-20-28(31(37)26-15-9-8-14-25(26)27)40-32-33-29(22-10-4-2-5-11-22)30(34-35-32)23-12-6-3-7-13-23/h2-20,36-37H,1H3 |
| InChIKey | VJHAPDPWILUBIQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|