C23H19NO4S — CID 21205833
N-[4-hydroxy-3-(4-hydroxy-3-methylphenyl)naphthalen-1-yl]benzenesulfonamide (PubChem CID 21205833) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[4-hydroxy-3-(4-hydroxy-3-methylphenyl)naphthalen-1-yl]benzenesulfonamide.
| Compound Name | N-[4-hydroxy-3-(4-hydroxy-3-methylphenyl)naphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 21205833 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[4-hydroxy-3-(4-hydroxy-3-methylphenyl)naphthalen-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(-c2cc(NS(=O)(=O)c3ccccc3)c3ccccc3c2O)ccc1O |
| InChI | InChI=1S/C23H19NO4S/c1-15-13-16(11-12-22(15)25)20-14-21(18-9-5-6-10-19(18)23(20)26)24-29(27,28)17-7-3-2-4-8-17/h2-14,24-26H,1H3 |
| InChIKey | UONNMVVEWZUDLJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|