C28H21NO5S — CID 58565479
4-acetyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]benzenesulfonamide (PubChem CID 58565479) has the molecular formula C28H21NO5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 4-acetyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 58565479 |
| Molecular Formula | C28H21NO5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 4-acetyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)Nc2cc(-c3c(O)ccc4ccccc34)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H21NO5S/c1-17(30)18-10-13-20(14-11-18)35(33,34)29-25-16-24(28(32)23-9-5-4-8-22(23)25)27-21-7-3-2-6-19(21)12-15-26(27)31/h2-16,29,31-32H,1H3 |
| InChIKey | NBFLDIFQGSWLOF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|