C33H33N3O6S — CID 170629988
[1-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]naphthalen-2-yl] N-methyl-N-[3-(methylamino)propyl]carbamate (PubChem CID 170629988) has the molecular formula C33H33N3O6S and a molecular weight of 599.71 g/mol. Its IUPAC name is [1-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]naphthalen-2-yl] N-methyl-N-[3-(methylamino)propyl]carbamate.
| Compound Name | [1-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]naphthalen-2-yl] N-methyl-N-[3-(methylamino)propyl]carbamate |
|---|---|
| PubChem CID | 170629988 |
| Molecular Formula | C33H33N3O6S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | [1-[1-hydroxy-4-[(4-methoxyphenyl)sulfonylamino]naphthalen-2-yl]naphthalen-2-yl] N-methyl-N-[3-(methylamino)propyl]carbamate |
| SMILES | CNCCCN(C)C(=O)Oc1ccc2ccccc2c1-c1cc(NS(=O)(=O)c2ccc(OC)cc2)c2ccccc2c1O |
| InChI | InChI=1S/C33H33N3O6S/c1-34-19-8-20-36(2)33(38)42-30-18-13-22-9-4-5-10-25(22)31(30)28-21-29(26-11-6-7-12-27(26)32(28)37)35-43(39,40)24-16-14-23(41-3)15-17-24/h4-7,9-18,21,34-35,37H,8,19-20H2,1-3H3 |
| InChIKey | AOMJEEXUIZRAHV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|