C27H18F3NO5S — CID 58565507
N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 58565507) has the molecular formula C27H18F3NO5S and a molecular weight of 525.50 g/mol. Its IUPAC name is N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 58565507 |
| Molecular Formula | C27H18F3NO5S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2c(O)ccc3ccccc23)c(O)c2ccccc12)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H18F3NO5S/c28-27(29,30)36-17-10-12-18(13-11-17)37(34,35)31-23-15-22(26(33)21-8-4-3-7-20(21)23)25-19-6-2-1-5-16(19)9-14-24(25)32/h1-15,31-33H |
| InChIKey | NPISNMFJODIAMJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|