C20H16F3NO5S2 — CID 122674267
N-[4-hydroxy-3-(2-hydroxyprop-2-enylsulfanyl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 122674267) has the molecular formula C20H16F3NO5S2 and a molecular weight of 471.48 g/mol. Its IUPAC name is N-[4-hydroxy-3-(2-hydroxyprop-2-enylsulfanyl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-hydroxy-3-(2-hydroxyprop-2-enylsulfanyl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 122674267 |
| Molecular Formula | C20H16F3NO5S2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | N-[4-hydroxy-3-(2-hydroxyprop-2-enylsulfanyl)naphthalen-1-yl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | C=C(O)CSc1cc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)c2ccccc2c1O |
| InChI | InChI=1S/C20H16F3NO5S2/c1-12(25)11-30-18-10-17(15-4-2-3-5-16(15)19(18)26)24-31(27,28)14-8-6-13(7-9-14)29-20(21,22)23/h2-10,24-26H,1,11H2 |
| InChIKey | FAMHAAYOIGQISV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|