C18H13ClFNO5S2 — CID 89493584
2-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid (PubChem CID 89493584) has the molecular formula C18H13ClFNO5S2 and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 89493584 |
| Molecular Formula | C18H13ClFNO5S2 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 2-[4-[(3-chloro-4-fluorophenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1cc(NS(=O)(=O)c2ccc(F)c(Cl)c2)c2ccccc2c1O |
| InChI | InChI=1S/C18H13ClFNO5S2/c19-13-7-10(5-6-14(13)20)28(25,26)21-15-8-16(27-9-17(22)23)18(24)12-4-2-1-3-11(12)15/h1-8,21,24H,9H2,(H,22,23) |
| InChIKey | FAWRHJHLXSIOTD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|