C19H16N2O7S2 — CID 2956660
2-[1-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid (PubChem CID 2956660) has the molecular formula C19H16N2O7S2 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-[1-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 2956660 |
| Molecular Formula | C19H16N2O7S2 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-[1-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1cc(SCC(=O)O)c(O)c2ccccc12 |
| InChI | InChI=1S/C19H16N2O7S2/c1-11-6-7-12(21(25)26)8-17(11)30(27,28)20-15-9-16(29-10-18(22)23)19(24)14-5-3-2-4-13(14)15/h2-9,20,24H,10H2,1H3,(H,22,23) |
| InChIKey | ABFJZAIMAMBGGU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|