C28H28N2O8S3 — CID 134141598
2-[1,4-bis[(4-ethoxyphenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid (PubChem CID 134141598) has the molecular formula C28H28N2O8S3 and a molecular weight of 616.74 g/mol. Its IUPAC name is 2-[1,4-bis[(4-ethoxyphenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1,4-bis[(4-ethoxyphenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 134141598 |
| Molecular Formula | C28H28N2O8S3 |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | 2-[1,4-bis[(4-ethoxyphenyl)sulfonylamino]naphthalen-2-yl]sulfanylacetic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(SCC(=O)O)c(NS(=O)(=O)c3ccc(OCC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H28N2O8S3/c1-3-37-19-9-13-21(14-10-19)40(33,34)29-25-17-26(39-18-27(31)32)28(24-8-6-5-7-23(24)25)30-41(35,36)22-15-11-20(12-16-22)38-4-2/h5-17,29-30H,3-4,18H2,1-2H3,(H,31,32) |
| InChIKey | LVLMXXAIHMKDCA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|