C33H32N4O4 — CID 177246847
[1-[1-hydroxy-4-[2-(4-methoxyphenyl)hydrazinyl]naphthalen-2-yl]naphthalen-2-yl] N-(pyrrolidin-2-ylmethyl)carbamate (PubChem CID 177246847) has the molecular formula C33H32N4O4 and a molecular weight of 548.64 g/mol. Its IUPAC name is [1-[1-hydroxy-4-[2-(4-methoxyphenyl)hydrazinyl]naphthalen-2-yl]naphthalen-2-yl] N-(pyrrolidin-2-ylmethyl)carbamate.
| Compound Name | [1-[1-hydroxy-4-[2-(4-methoxyphenyl)hydrazinyl]naphthalen-2-yl]naphthalen-2-yl] N-(pyrrolidin-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 177246847 |
| Molecular Formula | C33H32N4O4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | [1-[1-hydroxy-4-[2-(4-methoxyphenyl)hydrazinyl]naphthalen-2-yl]naphthalen-2-yl] N-(pyrrolidin-2-ylmethyl)carbamate |
| SMILES | COc1ccc(NNc2cc(-c3c(OC(=O)NCC4CCCN4)ccc4ccccc34)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H32N4O4/c1-40-24-15-13-22(14-16-24)36-37-29-19-28(32(38)27-11-5-4-10-26(27)29)31-25-9-3-2-7-21(25)12-17-30(31)41-33(39)35-20-23-8-6-18-34-23/h2-5,7,9-17,19,23,34,36-38H,6,8,18,20H2,1H3,(H,35,39) |
| InChIKey | NPSRAGHIPTWXPL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|