C32H27N3O4S — CID 58565573
1-benzyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 58565573) has the molecular formula C32H27N3O4S and a molecular weight of 549.65 g/mol. Its IUPAC name is 1-benzyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 58565573 |
| Molecular Formula | C32H27N3O4S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 1-benzyl-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1S(=O)(=O)Nc1cc(-c2c(O)ccc3ccccc23)c(O)c2ccccc12 |
| InChI | InChI=1S/C32H27N3O4S/c1-20-32(21(2)35(33-20)19-22-10-4-3-5-11-22)40(38,39)34-28-18-27(31(37)26-15-9-8-14-25(26)28)30-24-13-7-6-12-23(24)16-17-29(30)36/h3-18,34,36-37H,19H2,1-2H3 |
| InChIKey | UUFVTPIUUUOXOS-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|