C19H12ClF3N4O3S2 — CID 58565501
4-chloro-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 58565501) has the molecular formula C19H12ClF3N4O3S2 and a molecular weight of 500.91 g/mol. Its IUPAC name is 4-chloro-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58565501 |
| Molecular Formula | C19H12ClF3N4O3S2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | 4-chloro-N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Sc2ncn[nH]2)c(O)c2ccccc12)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12ClF3N4O3S2/c20-14-6-5-10(7-13(14)19(21,22)23)32(29,30)27-15-8-16(31-18-24-9-25-26-18)17(28)12-4-2-1-3-11(12)15/h1-9,27-28H,(H,24,25,26) |
| InChIKey | LLWSHMZQVCHJAF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|