C17H11ClF3NO4S — CID 144778852
N-(3-chloro-4-hydroxynaphthalen-1-yl)-4-hydroxy-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 144778852) has the molecular formula C17H11ClF3NO4S and a molecular weight of 417.79 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxynaphthalen-1-yl)-4-hydroxy-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-chloro-4-hydroxynaphthalen-1-yl)-4-hydroxy-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 144778852 |
| Molecular Formula | C17H11ClF3NO4S |
| Molecular Weight | 417.79 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | N-(3-chloro-4-hydroxynaphthalen-1-yl)-4-hydroxy-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(O)c2ccccc12)c1ccc(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11ClF3NO4S/c18-13-8-14(10-3-1-2-4-11(10)16(13)24)22-27(25,26)9-5-6-15(23)12(7-9)17(19,20)21/h1-8,22-24H |
| InChIKey | UZRXFNFVERCLNI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|