C13H9N5O3 — CID 76849006
4-nitro-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide (PubChem CID 76849006) has the molecular formula C13H9N5O3 and a molecular weight of 283.25 g/mol. Its IUPAC name is 4-nitro-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide.
| Compound Name | 4-nitro-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 76849006 |
| Molecular Formula | C13H9N5O3 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-nitro-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
| SMILES | O=C(Nc1ccnc2[nH]ncc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9N5O3/c19-13(8-1-3-9(4-2-8)18(20)21)16-11-5-6-14-12-10(11)7-15-17-12/h1-7H,(H2,14,15,16,17,19) |
| InChIKey | DXPVDBIFPYSIHJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|