C17H19N7O — CID 22120634
4-[[[amino(ethylamino)methylidene]amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide (PubChem CID 22120634) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-[[[amino(ethylamino)methylidene]amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide.
| Compound Name | 4-[[[amino(ethylamino)methylidene]amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 22120634 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-[[[amino(ethylamino)methylidene]amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
| SMILES | CCN/C(N)=N/Cc1ccc(C(=O)Nc2ccnc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C17H19N7O/c1-2-19-17(18)21-9-11-3-5-12(6-4-11)16(25)23-14-7-8-20-15-13(14)10-22-24-15/h3-8,10H,2,9H2,1H3,(H3,18,19,21)(H2,20,22,23,24,25) |
| InChIKey | IRCYTPIILPEWEW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|