C15H15N5O — CID 70270729
4-(2-aminoethyl)-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide (PubChem CID 70270729) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide.
| Compound Name | 4-(2-aminoethyl)-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 70270729 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-(2-aminoethyl)-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
| SMILES | NCCc1ccc(C(=O)Nc2ccnc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C15H15N5O/c16-7-5-10-1-3-11(4-2-10)15(21)19-13-6-8-17-14-12(13)9-18-20-14/h1-4,6,8-9H,5,7,16H2,(H2,17,18,19,20,21) |
| InChIKey | HAUXAVPNVJGWSQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |