C19H23N7O — CID 57324118
4-[[ethyl-(N'-ethylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide (PubChem CID 57324118) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is 4-[[ethyl-(N'-ethylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide.
| Compound Name | 4-[[ethyl-(N'-ethylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 57324118 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-[[ethyl-(N'-ethylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
| SMILES | CC/N=C(\N)N(CC)Cc1ccc(C(=O)Nc2ccnc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C19H23N7O/c1-3-21-19(20)26(4-2)12-13-5-7-14(8-6-13)18(27)24-16-9-10-22-17-15(16)11-23-25-17/h5-11H,3-4,12H2,1-2H3,(H2,20,21)(H2,22,23,24,25,27) |
| InChIKey | JCVODXRVOGBJKN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|