C15H19Cl2N7O2 — CID 22120499
4-[(diaminomethylideneamino)methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide;hydrate;dihydrochloride (PubChem CID 22120499) has the molecular formula C15H19Cl2N7O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is 4-[(diaminomethylideneamino)methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide;hydrate;dihydrochloride.
| Compound Name | 4-[(diaminomethylideneamino)methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 22120499 |
| Molecular Formula | C15H19Cl2N7O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 4-[(diaminomethylideneamino)methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide;hydrate;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCc1ccc(C(=O)Nc2ccnc3[nH]ncc23)cc1.O |
| InChI | InChI=1S/C15H15N7O.2ClH.H2O/c16-15(17)19-7-9-1-3-10(4-2-9)14(23)21-12-5-6-18-13-11(12)8-20-22-13;;;/h1-6,8H,7H2,(H4,16,17,19)(H2,18,20,21,22,23);2*1H;1H2 |
| InChIKey | YXKMHTRYAJKAKF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 166.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|