C20H25N5O3S — CID 9150303
1-[[4-(benzylamino)-3-nitrobenzoyl]amino]-3-pentylthiourea (PubChem CID 9150303) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[[4-(benzylamino)-3-nitrobenzoyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[4-(benzylamino)-3-nitrobenzoyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9150303 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[[4-(benzylamino)-3-nitrobenzoyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1ccc(NCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N5O3S/c1-2-3-7-12-21-20(29)24-23-19(26)16-10-11-17(18(13-16)25(27)28)22-14-15-8-5-4-6-9-15/h4-6,8-11,13,22H,2-3,7,12,14H2,1H3,(H,23,26)(H2,21,24,29) |
| InChIKey | KNQGVJHVTJBMDS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|