C17H27N5O3S — CID 9272424
1-[[4-(methylamino)-3-nitrobenzoyl]amino]-3-[(2R)-2-methylheptyl]thiourea (PubChem CID 9272424) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-[[4-(methylamino)-3-nitrobenzoyl]amino]-3-[(2R)-2-methylheptyl]thiourea.
| Compound Name | 1-[[4-(methylamino)-3-nitrobenzoyl]amino]-3-[(2R)-2-methylheptyl]thiourea |
|---|---|
| PubChem CID | 9272424 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-[[4-(methylamino)-3-nitrobenzoyl]amino]-3-[(2R)-2-methylheptyl]thiourea |
| SMILES | CCCCC[C@@H](C)CNC(=S)NNC(=O)c1ccc(NC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H27N5O3S/c1-4-5-6-7-12(2)11-19-17(26)21-20-16(23)13-8-9-14(18-3)15(10-13)22(24)25/h8-10,12,18H,4-7,11H2,1-3H3,(H,20,23)(H2,19,21,26)/t12-/m1/s1 |
| InChIKey | FGUBABIMHZXQIT-GFCCVEGCSA-N |
| XLogP | 2.96 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|