C17H27N3O3S2 — CID 9328086
1-[(2R)-2-methylheptyl]-3-[(4-methylsulfonylbenzoyl)amino]thiourea (PubChem CID 9328086) has the molecular formula C17H27N3O3S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-[(2R)-2-methylheptyl]-3-[(4-methylsulfonylbenzoyl)amino]thiourea.
| Compound Name | 1-[(2R)-2-methylheptyl]-3-[(4-methylsulfonylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 9328086 |
| Molecular Formula | C17H27N3O3S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[(2R)-2-methylheptyl]-3-[(4-methylsulfonylbenzoyl)amino]thiourea |
| SMILES | CCCCC[C@@H](C)CNC(=S)NNC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H27N3O3S2/c1-4-5-6-7-13(2)12-18-17(24)20-19-16(21)14-8-10-15(11-9-14)25(3,22)23/h8-11,13H,4-7,12H2,1-3H3,(H,19,21)(H2,18,20,24)/t13-/m1/s1 |
| InChIKey | HUPBGVRLPZKHAN-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|