C21H28N4O3S — CID 9328186
N-[4-[[[(2R)-2-methylheptyl]carbamothioylamino]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 9328186) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[4-[[[(2R)-2-methylheptyl]carbamothioylamino]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[(2R)-2-methylheptyl]carbamothioylamino]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9328186 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[4-[[[(2R)-2-methylheptyl]carbamothioylamino]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CCCCC[C@@H](C)CNC(=S)NNC(=O)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c1-3-4-5-7-15(2)14-22-21(29)25-24-19(26)16-9-11-17(12-10-16)23-20(27)18-8-6-13-28-18/h6,8-13,15H,3-5,7,14H2,1-2H3,(H,23,27)(H,24,26)(H2,22,25,29)/t15-/m1/s1 |
| InChIKey | VPVGTLUMDAINNI-OAHLLOKOSA-N |
| XLogP | 3.86 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|