C19H29N3OS — CID 9327938
1-(2,3-dihydro-1H-indene-5-carbonylamino)-3-[(2R)-2-methylheptyl]thiourea (PubChem CID 9327938) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indene-5-carbonylamino)-3-[(2R)-2-methylheptyl]thiourea.
| Compound Name | 1-(2,3-dihydro-1H-indene-5-carbonylamino)-3-[(2R)-2-methylheptyl]thiourea |
|---|---|
| PubChem CID | 9327938 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-(2,3-dihydro-1H-indene-5-carbonylamino)-3-[(2R)-2-methylheptyl]thiourea |
| SMILES | CCCCC[C@@H](C)CNC(=S)NNC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H29N3OS/c1-3-4-5-7-14(2)13-20-19(24)22-21-18(23)17-11-10-15-8-6-9-16(15)12-17/h10-12,14H,3-9,13H2,1-2H3,(H,21,23)(H2,20,22,24)/t14-/m1/s1 |
| InChIKey | PVCRTYLBXSHTQE-CQSZACIVSA-N |
| XLogP | 3.50 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|