C17H19N3O4 — CID 110887436
4-(benzylamino)-N-(1-hydroxypropan-2-yl)-3-nitrobenzamide (PubChem CID 110887436) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-(benzylamino)-N-(1-hydroxypropan-2-yl)-3-nitrobenzamide.
| Compound Name | 4-(benzylamino)-N-(1-hydroxypropan-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 110887436 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-(benzylamino)-N-(1-hydroxypropan-2-yl)-3-nitrobenzamide |
| SMILES | CC(CO)NC(=O)c1ccc(NCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N3O4/c1-12(11-21)19-17(22)14-7-8-15(16(9-14)20(23)24)18-10-13-5-3-2-4-6-13/h2-9,12,18,21H,10-11H2,1H3,(H,19,22) |
| InChIKey | FJNKVUUPJIIEKQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|