C14H13BrN4OS — CID 7977781
1-benzyl-3-[(5-bromopyridine-3-carbonyl)amino]thiourea (PubChem CID 7977781) has the molecular formula C14H13BrN4OS and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-benzyl-3-[(5-bromopyridine-3-carbonyl)amino]thiourea.
| Compound Name | 1-benzyl-3-[(5-bromopyridine-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 7977781 |
| Molecular Formula | C14H13BrN4OS |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 1-benzyl-3-[(5-bromopyridine-3-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccccc1)c1cncc(Br)c1 |
| InChI | InChI=1S/C14H13BrN4OS/c15-12-6-11(8-16-9-12)13(20)18-19-14(21)17-7-10-4-2-1-3-5-10/h1-6,8-9H,7H2,(H,18,20)(H2,17,19,21) |
| InChIKey | UVJFOSZPZZPFFM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|