C8H7N7O3S — CID 136890329
N'-hydroxy-3-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboximidamide (PubChem CID 136890329) has the molecular formula C8H7N7O3S and a molecular weight of 281.26 g/mol. Its IUPAC name is N'-hydroxy-3-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-3-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136890329 |
| Molecular Formula | C8H7N7O3S |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N'-hydroxy-3-nitro-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1nc(Sc2ncn[nH]2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N7O3S/c9-7(14-16)6-4(15(17)18)1-2-5(12-6)19-8-10-3-11-13-8/h1-3,16H,(H2,9,14)(H,10,11,13) |
| InChIKey | VRHJWFBWLYDYDZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 156.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|