C12H11N5O4 — CID 136890293
N'-hydroxy-6-[(6-methyl-3-pyridinyl)oxy]-3-nitropyridine-2-carboximidamide (PubChem CID 136890293) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is N'-hydroxy-6-[(6-methyl-3-pyridinyl)oxy]-3-nitropyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-6-[(6-methyl-3-pyridinyl)oxy]-3-nitropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136890293 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N'-hydroxy-6-[(6-methyl-3-pyridinyl)oxy]-3-nitropyridine-2-carboximidamide |
| SMILES | Cc1ccc(Oc2ccc([N+](=O)[O-])c(/C(N)=N/O)n2)cn1 |
| InChI | InChI=1S/C12H11N5O4/c1-7-2-3-8(6-14-7)21-10-5-4-9(17(19)20)11(15-10)12(13)16-18/h2-6,18H,1H3,(H2,13,16) |
| InChIKey | LSOOPVAHPXDQBM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|