C8H10N4O4 — CID 136890257
6-ethoxy-N'-hydroxy-3-nitropyridine-2-carboximidamide (PubChem CID 136890257) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 6-ethoxy-N'-hydroxy-3-nitropyridine-2-carboximidamide.
| Compound Name | 6-ethoxy-N'-hydroxy-3-nitropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136890257 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 6-ethoxy-N'-hydroxy-3-nitropyridine-2-carboximidamide |
| SMILES | CCOc1ccc([N+](=O)[O-])c(/C(N)=N/O)n1 |
| InChI | InChI=1S/C8H10N4O4/c1-2-16-6-4-3-5(12(14)15)7(10-6)8(9)11-13/h3-4,13H,2H2,1H3,(H2,9,11) |
| InChIKey | NGMRGODHNKSBCS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|