C12H18N6O3 — CID 136768896
6-(4-ethylpiperazin-1-yl)-N'-hydroxy-3-nitropyridine-2-carboximidamide (PubChem CID 136768896) has the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-3-nitropyridine-2-carboximidamide.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-3-nitropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136768896 |
| Molecular Formula | C12H18N6O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-N'-hydroxy-3-nitropyridine-2-carboximidamide |
| SMILES | CCN1CCN(c2ccc([N+](=O)[O-])c(/C(N)=N/O)n2)CC1 |
| InChI | InChI=1S/C12H18N6O3/c1-2-16-5-7-17(8-6-16)10-4-3-9(18(20)21)11(14-10)12(13)15-19/h3-4,19H,2,5-8H2,1H3,(H2,13,15) |
| InChIKey | VNQDHFJUYRDAPK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|