C9H7IN6O3 — CID 136890236
N'-hydroxy-6-(4-iodopyrazol-1-yl)-3-nitropyridine-2-carboximidamide (PubChem CID 136890236) has the molecular formula C9H7IN6O3 and a molecular weight of 374.10 g/mol. Its IUPAC name is N'-hydroxy-6-(4-iodopyrazol-1-yl)-3-nitropyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-6-(4-iodopyrazol-1-yl)-3-nitropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136890236 |
| Molecular Formula | C9H7IN6O3 |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | N'-hydroxy-6-(4-iodopyrazol-1-yl)-3-nitropyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1nc(-n2cc(I)cn2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7IN6O3/c10-5-3-12-15(4-5)7-2-1-6(16(18)19)8(13-7)9(11)14-17/h1-4,17H,(H2,11,14) |
| InChIKey | AZGRZCMEJAPXOH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|