C10H12N4O4 — CID 136967800
6-cyclobutyloxy-N'-hydroxy-3-nitropyridine-2-carboximidamide (PubChem CID 136967800) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 6-cyclobutyloxy-N'-hydroxy-3-nitropyridine-2-carboximidamide.
| Compound Name | 6-cyclobutyloxy-N'-hydroxy-3-nitropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136967800 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 6-cyclobutyloxy-N'-hydroxy-3-nitropyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1nc(OC2CCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N4O4/c11-10(13-15)9-7(14(16)17)4-5-8(12-9)18-6-2-1-3-6/h4-6,15H,1-3H2,(H2,11,13) |
| InChIKey | YOIHQVUBJBVLMW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|