C10H11F3N4O4 — CID 136890310
N'-hydroxy-3-nitro-6-(4,4,4-trifluorobutoxy)pyridine-2-carboximidamide (PubChem CID 136890310) has the molecular formula C10H11F3N4O4 and a molecular weight of 308.22 g/mol. Its IUPAC name is N'-hydroxy-3-nitro-6-(4,4,4-trifluorobutoxy)pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-3-nitro-6-(4,4,4-trifluorobutoxy)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136890310 |
| Molecular Formula | C10H11F3N4O4 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N'-hydroxy-3-nitro-6-(4,4,4-trifluorobutoxy)pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1nc(OCCCC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11F3N4O4/c11-10(12,13)4-1-5-21-7-3-2-6(17(19)20)8(15-7)9(14)16-18/h2-3,18H,1,4-5H2,(H2,14,16) |
| InChIKey | UDWJHDSVPDCMLD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|