C9H12N4O4S — CID 136967804
N'-hydroxy-6-(2-methoxyethylsulfanyl)-3-nitropyridine-2-carboximidamide (PubChem CID 136967804) has the molecular formula C9H12N4O4S and a molecular weight of 272.29 g/mol. Its IUPAC name is N'-hydroxy-6-(2-methoxyethylsulfanyl)-3-nitropyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-6-(2-methoxyethylsulfanyl)-3-nitropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136967804 |
| Molecular Formula | C9H12N4O4S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N'-hydroxy-6-(2-methoxyethylsulfanyl)-3-nitropyridine-2-carboximidamide |
| SMILES | COCCSc1ccc([N+](=O)[O-])c(/C(N)=N/O)n1 |
| InChI | InChI=1S/C9H12N4O4S/c1-17-4-5-18-7-3-2-6(13(15)16)8(11-7)9(10)12-14/h2-3,14H,4-5H2,1H3,(H2,10,12) |
| InChIKey | VBDKLUMIYYRYRF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|