C10H11N7O3S — CID 136890369
6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-3-nitropyridine-2-carboximidamide (PubChem CID 136890369) has the molecular formula C10H11N7O3S and a molecular weight of 309.31 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-3-nitropyridine-2-carboximidamide.
| Compound Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-3-nitropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136890369 |
| Molecular Formula | C10H11N7O3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-3-nitropyridine-2-carboximidamide |
| SMILES | Cc1nnc(Sc2ccc([N+](=O)[O-])c(/C(N)=N/O)n2)n1C |
| InChI | InChI=1S/C10H11N7O3S/c1-5-13-14-10(16(5)2)21-7-4-3-6(17(19)20)8(12-7)9(11)15-18/h3-4,18H,1-2H3,(H2,11,15) |
| InChIKey | DZKAQRGUZIKOOO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|