C9H10N6O2S — CID 80889283
6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridin-2-amine (PubChem CID 80889283) has the molecular formula C9H10N6O2S and a molecular weight of 266.29 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridin-2-amine.
| Compound Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80889283 |
| Molecular Formula | C9H10N6O2S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridin-2-amine |
| SMILES | Cc1nnc(Sc2nc(N)ccc2[N+](=O)[O-])n1C |
| InChI | InChI=1S/C9H10N6O2S/c1-5-12-13-9(14(5)2)18-8-6(15(16)17)3-4-7(10)11-8/h3-4H,1-2H3,(H2,10,11) |
| InChIKey | YFHXFKCXVIRPHX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|