C9H9N7O2S — CID 80885230
2-[(6-amino-3-nitro-2-pyridinyl)sulfanyl]pyrimidine-4,6-diamine (PubChem CID 80885230) has the molecular formula C9H9N7O2S and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-[(6-amino-3-nitro-2-pyridinyl)sulfanyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[(6-amino-3-nitro-2-pyridinyl)sulfanyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80885230 |
| Molecular Formula | C9H9N7O2S |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[(6-amino-3-nitro-2-pyridinyl)sulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(Sc2nc(N)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H9N7O2S/c10-5-2-1-4(16(17)18)8(13-5)19-9-14-6(11)3-7(12)15-9/h1-3H,(H2,10,13)(H4,11,12,14,15) |
| InChIKey | MCTZBJVXTAZAQF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 159.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|