C11H10N4O4S — CID 115542662
3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid (PubChem CID 115542662) has the molecular formula C11H10N4O4S and a molecular weight of 294.29 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid.
| Compound Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 115542662 |
| Molecular Formula | C11H10N4O4S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid |
| SMILES | Cc1nnc(Sc2cccc(C(=O)O)c2[N+](=O)[O-])n1C |
| InChI | InChI=1S/C11H10N4O4S/c1-6-12-13-11(14(6)2)20-8-5-3-4-7(10(16)17)9(8)15(18)19/h3-5H,1-2H3,(H,16,17) |
| InChIKey | HPZMBYCCNKJGPK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|