C11H15N3O4S — CID 77008653
N'-hydroxy-4-(3-methoxypropylsulfanyl)-3-nitrobenzenecarboximidamide (PubChem CID 77008653) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is N'-hydroxy-4-(3-methoxypropylsulfanyl)-3-nitrobenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-(3-methoxypropylsulfanyl)-3-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 77008653 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N'-hydroxy-4-(3-methoxypropylsulfanyl)-3-nitrobenzenecarboximidamide |
| SMILES | COCCCSc1ccc(C(N)=NO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O4S/c1-18-5-2-6-19-10-4-3-8(11(12)13-15)7-9(10)14(16)17/h3-4,7,15H,2,5-6H2,1H3,(H2,12,13) |
| InChIKey | QZZHMFTYSHSBSX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|