C10H13BrN2O2S — CID 82799158
3-bromo-N'-hydroxy-4-(2-methoxyethylsulfanyl)benzenecarboximidamide (PubChem CID 82799158) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is 3-bromo-N'-hydroxy-4-(2-methoxyethylsulfanyl)benzenecarboximidamide.
| Compound Name | 3-bromo-N'-hydroxy-4-(2-methoxyethylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 82799158 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3-bromo-N'-hydroxy-4-(2-methoxyethylsulfanyl)benzenecarboximidamide |
| SMILES | COCCSc1ccc(/C(N)=N/O)cc1Br |
| InChI | InChI=1S/C10H13BrN2O2S/c1-15-4-5-16-9-3-2-7(6-8(9)11)10(12)13-14/h2-3,6,14H,4-5H2,1H3,(H2,12,13) |
| InChIKey | QLAZGPPWANJIAR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|