About 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide
3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide (PubChem CID 82799691) has the molecular formula C10H11BrN2O2S
and a molecular weight of 303.18 g/mol. Its IUPAC name is 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide |
| PubChem CID | 82799691 |
| Molecular Formula | C10H11BrN2O2S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(SC2COC2)c(Br)c1 |
| InChI | InChI=1S/C10H11BrN2O2S/c11-8-3-6(10(12)13-14)1-2-9(8)16-7-4-15-5-7/h1-3,7,14H,4-5H2,(H2,12,13) |
| InChIKey | GQKMBXIKAHBRGS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide?
The IUPAC name of 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide (CID 82799691) is 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide.
What is the SMILES notation for 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide?
The canonical SMILES for 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide is N/C(=N/O)c1ccc(SC2COC2)c(Br)c1.
What is the InChIKey of 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide?
The InChIKey is GQKMBXIKAHBRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O2S/c11-8-3-6(10(12)13-14)1-2-9(8)16-7-4-15-5-7/h1-3,7,14H,4-5H2,(H2,12,13).
What are the key properties of 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide?
3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide has a molecular weight of 303.18 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N'-hydroxy-4-(oxetan-3-ylsulfanyl)benzenecarboximidamide is sourced from PubChem (CID 82799691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).