About 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide
4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide (PubChem CID 80695376) has the molecular formula C9H10FN3O4
and a molecular weight of 243.19 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide |
| PubChem CID | 80695376 |
| Molecular Formula | C9H10FN3O4 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(OCCF)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10FN3O4/c10-3-4-17-8-2-1-6(9(11)12-14)5-7(8)13(15)16/h1-2,5,14H,3-4H2,(H2,11,12) |
| InChIKey | SZRGKNNADPEJPV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide?
The IUPAC name of 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide (CID 80695376) is 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide.
What is the SMILES notation for 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide?
The canonical SMILES for 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide is N/C(=N/O)c1ccc(OCCF)c([N+](=O)[O-])c1.
What is the InChIKey of 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide?
The InChIKey is SZRGKNNADPEJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O4/c10-3-4-17-8-2-1-6(9(11)12-14)5-7(8)13(15)16/h1-2,5,14H,3-4H2,(H2,11,12).
What are the key properties of 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide?
4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide has a molecular weight of 243.19 g/mol, XLogP of 1.04, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethoxy)-N'-hydroxy-3-nitrobenzenecarboximidamide is sourced from PubChem (CID 80695376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).