C11H15N3O4 — CID 77022770
3-(4-ethyl-2-nitrophenoxy)-N'-hydroxypropanimidamide (PubChem CID 77022770) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-(4-ethyl-2-nitrophenoxy)-N'-hydroxypropanimidamide.
| Compound Name | 3-(4-ethyl-2-nitrophenoxy)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77022770 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-(4-ethyl-2-nitrophenoxy)-N'-hydroxypropanimidamide |
| SMILES | CCc1ccc(OCCC(N)=NO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15N3O4/c1-2-8-3-4-10(9(7-8)14(16)17)18-6-5-11(12)13-15/h3-4,7,15H,2,5-6H2,1H3,(H2,12,13) |
| InChIKey | DRKRCLRZJYWWSL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|