C8H5ClN4O2S — CID 56772708
5-(2-chloro-6-nitrophenyl)sulfanyl-1H-1,2,4-triazole (PubChem CID 56772708) has the molecular formula C8H5ClN4O2S and a molecular weight of 256.67 g/mol. Its IUPAC name is 5-(2-chloro-6-nitrophenyl)sulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-(2-chloro-6-nitrophenyl)sulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 56772708 |
| Molecular Formula | C8H5ClN4O2S |
| Molecular Weight | 256.67 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 5-(2-chloro-6-nitrophenyl)sulfanyl-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1Sc1ncn[nH]1 |
| InChI | InChI=1S/C8H5ClN4O2S/c9-5-2-1-3-6(13(14)15)7(5)16-8-10-4-11-12-8/h1-4H,(H,10,11,12) |
| InChIKey | NZPFZUXXKQYMLC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|