C7H7N7O2 — CID 61147060
5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-2-amine (PubChem CID 61147060) has the molecular formula C7H7N7O2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 61147060 |
| Molecular Formula | C7H7N7O2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ncn[nH]2)nc1 |
| InChI | InChI=1S/C7H7N7O2/c15-14(16)5-1-8-7(9-2-5)10-3-6-11-4-12-13-6/h1-2,4H,3H2,(H,8,9,10)(H,11,12,13) |
| InChIKey | BEZBPZADVOQCBX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|