C11H11N5O3 — CID 895114
(2R)-2-(4-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)propanamide (PubChem CID 895114) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is (2R)-2-(4-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)propanamide.
| Compound Name | (2R)-2-(4-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)propanamide |
|---|---|
| PubChem CID | 895114 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (2R)-2-(4-nitrophenyl)-N-(1H-1,2,4-triazol-5-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ncn[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11N5O3/c1-7(10(17)14-11-12-6-13-15-11)8-2-4-9(5-3-8)16(18)19/h2-7H,1H3,(H2,12,13,14,15,17)/t7-/m1/s1 |
| InChIKey | DZZDPZKEIKWDFO-SSDOTTSWSA-N |
| XLogP | 1.46 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|