C3H5N5O2 — CID 3902379
4-nitro-1H-pyrazole-3,5-diamine (PubChem CID 3902379) has the molecular formula C3H5N5O2 and a molecular weight of 143.11 g/mol. Its IUPAC name is 4-nitro-1H-pyrazole-3,5-diamine.
| Compound Name | 4-nitro-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 3902379 |
| Molecular Formula | C3H5N5O2 |
| Molecular Weight | 143.11 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 4-nitro-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C3H5N5O2/c4-2-1(8(9)10)3(5)7-6-2/h(H5,4,5,6,7) |
| InChIKey | WOVRMGLBHQMAFH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.11 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|