C9H7N7O2 — CID 3112996
4-nitro-3,5-bis(1H-pyrazol-4-yl)-1H-pyrazole (PubChem CID 3112996) has the molecular formula C9H7N7O2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 4-nitro-3,5-bis(1H-pyrazol-4-yl)-1H-pyrazole.
| Compound Name | 4-nitro-3,5-bis(1H-pyrazol-4-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 3112996 |
| Molecular Formula | C9H7N7O2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-nitro-3,5-bis(1H-pyrazol-4-yl)-1H-pyrazole |
| SMILES | O=[N+]([O-])c1c(-c2cn[nH]c2)n[nH]c1-c1cn[nH]c1 |
| InChI | InChI=1S/C9H7N7O2/c17-16(18)9-7(5-1-10-11-2-5)14-15-8(9)6-3-12-13-4-6/h1-4H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | OMPHEYNAVULYPH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|